(-)-Ampelopsin B

Ampelopsin B
Ampelopsin B.svg
IUPAC name
Other names
(+)-Ampelopsin B
(−)-Ampelopsin B
3D model (JSmol)
  • InChI=1S/C28H22O6/c29-17-5-1-14(2-6-17)21-10-16-9-19(31)13-24-25(16)27(22-11-20(32)12-23(33)26(21)22)28(34-24)15-3-7-18(30)8-4-15/h1-9,11-13,21,27-33H,10H2/t21-,27-,28+/m0/s1
  • InChI=1/C28H22O6/c29-17-5-1-14(2-6-17)21-10-16-9-19(31)13-24-25(16)27(22-11-20(32)12-23(33)26(21)22)28(34-24)15-3-7-18(30)8-4-15/h1-9,11-13,21,27-33H,10H2/t21-,27-,28+/m0/s1
  • Oc1ccc(cc1)[C@H]6c2c(cc(O)cc2O)[C@H]4c5c(cc(O)cc5O[C@@H]4c3ccc(O)cc3)C6
Molar mass 454.478 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).

Ampelopsin B is a stilbenoid dimer found in Ampelopsis glandulosa var. hancei (formerly Ampelopsis brevipedunculata var. hancei).[1][2]


  1. ^ Oshima, Y (1990). "Ampelopsins A, B and C, new oligostilbenes of Ampelopsis brevipedunculata var hancei". Tetrahedron. 46 (15): 5121. doi:10.1016/S0040-4020(01)87819-4.
  2. ^ Chemical determination of the absolute structures of resveratrol dimers, ampelopsins A, B, D and F. Yoshiaki Takaya, Ke-Xu Yan, Kenji Terashima, Junko Ito and Masatake Niwa, Tetrahedron, 2002, 58, pages 7259–7265, doi:10.1016/S0040-4020(02)00785-8